C20H18ClN3O4S2 — CID 2485589
4-chloro-2-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid (PubChem CID 2485589) has the molecular formula C20H18ClN3O4S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is 4-chloro-2-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2485589 |
| Molecular Formula | C20H18ClN3O4S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 4-chloro-2-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)ccc2C(=O)O)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C20H18ClN3O4S2/c1-4-7-24-18(26)16-10(2)11(3)30-17(16)23-20(24)29-9-15(25)22-14-8-12(21)5-6-13(14)19(27)28/h4-6,8H,1,7,9H2,2-3H3,(H,22,25)(H,27,28) |
| InChIKey | QDTTVCUSBKCGGD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|