C14H12F3N3O3 — CID 24856178
N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 24856178) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24856178 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)CC(=O)Nc2ccc(F)c(F)c2F)no1 |
| InChI | InChI=1S/C14H12F3N3O3/c1-7-5-10(19-23-7)14(22)20(2)6-11(21)18-9-4-3-8(15)12(16)13(9)17/h3-5H,6H2,1-2H3,(H,18,21) |
| InChIKey | CKUJXYCGVXCMIZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|