About [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate
[1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 24856506) has the molecular formula C19H24F2N2O3
and a molecular weight of 366.41 g/mol. Its IUPAC name is [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
Molecular Properties
| Compound Name | [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| PubChem CID | 24856506 |
| Molecular Formula | C19H24F2N2O3 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | O=C(OC1CCCN(c2ccc(F)cc2F)C1)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C19H24F2N2O3/c20-12-3-6-18(17(21)8-12)22-7-1-2-16(11-22)26-19(25)23-13-4-5-14(23)10-15(24)9-13/h3,6,8,13-16,24H,1-2,4-5,7,9-11H2 |
| InChIKey | AHXIWIWMPRCLEC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 24856506) is [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate is O=C(OC1CCCN(c2ccc(F)cc2F)C1)N1C2CCC1CC(O)C2.
What is the InChIKey of [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is AHXIWIWMPRCLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N2O3/c20-12-3-6-18(17(21)8-12)22-7-1-2-16(11-22)26-19(25)23-13-4-5-14(23)10-15(24)9-13/h3,6,8,13-16,24H,1-2,4-5,7,9-11H2.
What are the key properties of [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
[1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 366.41 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4-difluorophenyl)piperidin-3-yl] 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 24856506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).