C22H25ClN8O3S — CID 24856575
N-(2-chloro-6-methylphenyl)-2-[[6-[4-[2-(hydroxyamino)-2-oxoethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 24856575) has the molecular formula C22H25ClN8O3S and a molecular weight of 517.02 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-[2-(hydroxyamino)-2-oxoethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[2-(hydroxyamino)-2-oxoethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24856575 |
| Molecular Formula | C22H25ClN8O3S |
| Molecular Weight | 517.02 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[2-(hydroxyamino)-2-oxoethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CC(=O)NO)CC2)n1 |
| InChI | InChI=1S/C22H25ClN8O3S/c1-13-4-3-5-15(23)20(13)28-21(33)16-11-24-22(35-16)27-17-10-18(26-14(2)25-17)31-8-6-30(7-9-31)12-19(32)29-34/h3-5,10-11,34H,6-9,12H2,1-2H3,(H,28,33)(H,29,32)(H,24,25,26,27) |
| InChIKey | XBSRSOMLIPRLGT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.02 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|