C24H29ClN8O3S — CID 24856655
N-(2-chloro-6-methylphenyl)-2-[[6-[4-[4-(hydroxyamino)-4-oxobutyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 24856655) has the molecular formula C24H29ClN8O3S and a molecular weight of 545.07 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-[4-(hydroxyamino)-4-oxobutyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[4-(hydroxyamino)-4-oxobutyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24856655 |
| Molecular Formula | C24H29ClN8O3S |
| Molecular Weight | 545.07 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[4-(hydroxyamino)-4-oxobutyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCCC(=O)NO)CC2)n1 |
| InChI | InChI=1S/C24H29ClN8O3S/c1-15-5-3-6-17(25)22(15)30-23(35)18-14-26-24(37-18)29-19-13-20(28-16(2)27-19)33-11-9-32(10-12-33)8-4-7-21(34)31-36/h3,5-6,13-14,36H,4,7-12H2,1-2H3,(H,30,35)(H,31,34)(H,26,27,28,29) |
| InChIKey | CSKVSJGFZCDLPZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.07 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|