C25H31ClN8O3S — CID 24856656
N-(2-chloro-6-methylphenyl)-2-[[6-[4-[5-(hydroxyamino)-5-oxopentyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 24856656) has the molecular formula C25H31ClN8O3S and a molecular weight of 559.10 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-[5-(hydroxyamino)-5-oxopentyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[5-(hydroxyamino)-5-oxopentyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24856656 |
| Molecular Formula | C25H31ClN8O3S |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[5-(hydroxyamino)-5-oxopentyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCCCC(=O)NO)CC2)n1 |
| InChI | InChI=1S/C25H31ClN8O3S/c1-16-6-5-7-18(26)23(16)31-24(36)19-15-27-25(38-19)30-20-14-21(29-17(2)28-20)34-12-10-33(11-13-34)9-4-3-8-22(35)32-37/h5-7,14-15,37H,3-4,8-13H2,1-2H3,(H,31,36)(H,32,35)(H,27,28,29,30) |
| InChIKey | VVVNGZRRKGBVHW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|