C26H33ClN8O3S — CID 24856657
N-(2-chloro-6-methylphenyl)-2-[[6-[4-[6-(hydroxyamino)-6-oxohexyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 24856657) has the molecular formula C26H33ClN8O3S and a molecular weight of 573.12 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-[6-(hydroxyamino)-6-oxohexyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[6-(hydroxyamino)-6-oxohexyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24856657 |
| Molecular Formula | C26H33ClN8O3S |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[6-(hydroxyamino)-6-oxohexyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCCCCC(=O)NO)CC2)n1 |
| InChI | InChI=1S/C26H33ClN8O3S/c1-17-7-6-8-19(27)24(17)32-25(37)20-16-28-26(39-20)31-21-15-22(30-18(2)29-21)35-13-11-34(12-14-35)10-5-3-4-9-23(36)33-38/h6-8,15-16,38H,3-5,9-14H2,1-2H3,(H,32,37)(H,33,36)(H,28,29,30,31) |
| InChIKey | INQFRPJTGHFXGC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|