C27H35ClN8O3S — CID 24856658
N-(2-chloro-6-methylphenyl)-2-[[6-[4-[7-(hydroxyamino)-7-oxoheptyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 24856658) has the molecular formula C27H35ClN8O3S and a molecular weight of 587.15 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-[7-(hydroxyamino)-7-oxoheptyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[7-(hydroxyamino)-7-oxoheptyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24856658 |
| Molecular Formula | C27H35ClN8O3S |
| Molecular Weight | 587.15 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[7-(hydroxyamino)-7-oxoheptyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCCCCCC(=O)NO)CC2)n1 |
| InChI | InChI=1S/C27H35ClN8O3S/c1-18-8-7-9-20(28)25(18)33-26(38)21-17-29-27(40-21)32-22-16-23(31-19(2)30-22)36-14-12-35(13-15-36)11-6-4-3-5-10-24(37)34-39/h7-9,16-17,39H,3-6,10-15H2,1-2H3,(H,33,38)(H,34,37)(H,29,30,31,32) |
| InChIKey | VVOZEBRBZHBKDL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.15 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|