About [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate
[1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate (PubChem CID 24856683) has the molecular formula C20H26FN3O3
and a molecular weight of 375.44 g/mol. Its IUPAC name is [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate.
Molecular Properties
| Compound Name | [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate |
| PubChem CID | 24856683 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate |
| SMILES | Nc1ccc(N2CCCC(OC(=O)N3C4CC5CC(C4)OC3C5)C2)c(F)c1 |
| InChI | InChI=1S/C20H26FN3O3/c21-17-9-13(22)3-4-18(17)23-5-1-2-15(11-23)27-20(25)24-14-6-12-7-16(10-14)26-19(24)8-12/h3-4,9,12,14-16,19H,1-2,5-8,10-11,22H2 |
| InChIKey | LIWHVNVUFIQQHX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate?
The IUPAC name of [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate (CID 24856683) is [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate.
What is the SMILES notation for [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate?
The canonical SMILES for [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate is Nc1ccc(N2CCCC(OC(=O)N3C4CC5CC(C4)OC3C5)C2)c(F)c1.
What is the InChIKey of [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate?
The InChIKey is LIWHVNVUFIQQHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FN3O3/c21-17-9-13(22)3-4-18(17)23-5-1-2-15(11-23)27-20(25)24-14-6-12-7-16(10-14)26-19(24)8-12/h3-4,9,12,14-16,19H,1-2,5-8,10-11,22H2.
What are the key properties of [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate?
[1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate has a molecular weight of 375.44 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-amino-2-fluorophenyl)piperidin-3-yl] 2-oxa-4-azatricyclo[3.3.1.13,7]decane-4-carboxylate is sourced from PubChem (CID 24856683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).