C20H21ClN6O4S — CID 24856818
N-(2-chloro-6-methylphenyl)-2-[[6-[4-(hydroxyamino)-4-oxobutoxy]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 24856818) has the molecular formula C20H21ClN6O4S and a molecular weight of 476.95 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-(hydroxyamino)-4-oxobutoxy]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-(hydroxyamino)-4-oxobutoxy]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24856818 |
| Molecular Formula | C20H21ClN6O4S |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-(hydroxyamino)-4-oxobutoxy]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(OCCCC(=O)NO)n1 |
| InChI | InChI=1S/C20H21ClN6O4S/c1-11-5-3-6-13(21)18(11)26-19(29)14-10-22-20(32-14)25-15-9-17(24-12(2)23-15)31-8-4-7-16(28)27-30/h3,5-6,9-10,30H,4,7-8H2,1-2H3,(H,26,29)(H,27,28)(H,22,23,24,25) |
| InChIKey | LSHGMRYQYDCRRR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|