C23H20FN5O3 — CID 24856848
2-fluoro-4-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzoic acid (PubChem CID 24856848) has the molecular formula C23H20FN5O3 and a molecular weight of 433.44 g/mol. Its IUPAC name is 2-fluoro-4-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzoic acid.
| Compound Name | 2-fluoro-4-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 24856848 |
| Molecular Formula | C23H20FN5O3 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-fluoro-4-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cnc(Nc3ccc(N4CCOCC4)cc3)c3nccn23)cc1F |
| InChI | InChI=1S/C23H20FN5O3/c24-19-13-15(1-6-18(19)23(30)31)20-14-26-21(22-25-7-8-29(20)22)27-16-2-4-17(5-3-16)28-9-11-32-12-10-28/h1-8,13-14H,9-12H2,(H,26,27)(H,30,31) |
| InChIKey | NIFGYIWOYZGGKP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|