C20H22N8O — CID 24857007
N-[2-(ethylamino)ethyl]-4-[[5-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide (PubChem CID 24857007) has the molecular formula C20H22N8O and a molecular weight of 390.45 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-[[5-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide.
| Compound Name | N-[2-(ethylamino)ethyl]-4-[[5-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
|---|---|
| PubChem CID | 24857007 |
| Molecular Formula | C20H22N8O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-[[5-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
| SMILES | CCNCCNC(=O)c1ccc(Nc2ncc(-c3cn[nH]c3)n3ccnc23)cc1 |
| InChI | InChI=1S/C20H22N8O/c1-2-21-7-8-23-20(29)14-3-5-16(6-4-14)27-18-19-22-9-10-28(19)17(13-24-18)15-11-25-26-12-15/h3-6,9-13,21H,2,7-8H2,1H3,(H,23,29)(H,24,27)(H,25,26) |
| InChIKey | VBWIDYTWNTYFFO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|