About (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone
(2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone (PubChem CID 24857103) has the molecular formula C21H15ClF2N4O2
and a molecular weight of 428.83 g/mol. Its IUPAC name is (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone.
Molecular Properties
| Compound Name | (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone |
| PubChem CID | 24857103 |
| Molecular Formula | C21H15ClF2N4O2 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone |
| SMILES | CC(C)n1c(C(=O)c2ccccc2Cl)nc2cnc(Oc3c(F)cccc3F)nc21 |
| InChI | InChI=1S/C21H15ClF2N4O2/c1-11(2)28-19-16(26-20(28)17(29)12-6-3-4-7-13(12)22)10-25-21(27-19)30-18-14(23)8-5-9-15(18)24/h3-11H,1-2H3 |
| InChIKey | SWCUPKSQNAITSK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone?
The IUPAC name of (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone (CID 24857103) is (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone.
What is the SMILES notation for (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone?
The canonical SMILES for (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone is CC(C)n1c(C(=O)c2ccccc2Cl)nc2cnc(Oc3c(F)cccc3F)nc21.
What is the InChIKey of (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone?
The InChIKey is SWCUPKSQNAITSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClF2N4O2/c1-11(2)28-19-16(26-20(28)17(29)12-6-3-4-7-13(12)22)10-25-21(27-19)30-18-14(23)8-5-9-15(18)24/h3-11H,1-2H3.
What are the key properties of (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone?
(2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone has a molecular weight of 428.83 g/mol, XLogP of 5.36, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)-[2-(2,6-difluorophenoxy)-9-propan-2-ylpurin-8-yl]methanone is sourced from PubChem (CID 24857103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).