C27H34ClN3O3 — CID 24857270
[5-[[2-[(4-chlorophenyl)methoxy]ethyl-dimethylazaniumyl]methyl]-1,2,4-oxadiazol-3-yl]-cyclohexyl-phenylmethanolate (PubChem CID 24857270) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is [5-[[2-[(4-chlorophenyl)methoxy]ethyl-dimethylazaniumyl]methyl]-1,2,4-oxadiazol-3-yl]-cyclohexyl-phenylmethanolate.
| Compound Name | [5-[[2-[(4-chlorophenyl)methoxy]ethyl-dimethylazaniumyl]methyl]-1,2,4-oxadiazol-3-yl]-cyclohexyl-phenylmethanolate |
|---|---|
| PubChem CID | 24857270 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [5-[[2-[(4-chlorophenyl)methoxy]ethyl-dimethylazaniumyl]methyl]-1,2,4-oxadiazol-3-yl]-cyclohexyl-phenylmethanolate |
| SMILES | C[N+](C)(CCOCc1ccc(Cl)cc1)Cc1nc(C([O-])(c2ccccc2)C2CCCCC2)no1 |
| InChI | InChI=1S/C27H34ClN3O3/c1-31(2,17-18-33-20-21-13-15-24(28)16-14-21)19-25-29-26(30-34-25)27(32,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3,5-6,9-10,13-16,23H,4,7-8,11-12,17-20H2,1-2H3 |
| InChIKey | MOTJXBNEYVQWAB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|