C21H22FN3O4S2 — CID 24857291
[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 24857291) has the molecular formula C21H22FN3O4S2 and a molecular weight of 463.56 g/mol. Its IUPAC name is [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24857291 |
| Molecular Formula | C21H22FN3O4S2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H22FN3O4S2/c1-2-17-13-30-21(23-17)19(24-20(26)12-15-4-3-5-16(22)10-15)11-14-6-8-18(9-7-14)25-31(27,28)29/h3-10,13,19,25H,2,11-12H2,1H3,(H,24,26)(H,27,28,29)/t19-/m0/s1 |
| InChIKey | OWQRDPCPQKJXGQ-IBGZPJMESA-N |
| XLogP | 3.70 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|