C22H25N3O4S2 — CID 24857472
[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-(3-phenylpropanoylamino)ethyl]phenyl]sulfamic acid (PubChem CID 24857472) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-(3-phenylpropanoylamino)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-(3-phenylpropanoylamino)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24857472 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-(3-phenylpropanoylamino)ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)CCc2ccccc2)n1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-2-18-15-30-22(23-18)20(24-21(26)13-10-16-6-4-3-5-7-16)14-17-8-11-19(12-9-17)25-31(27,28)29/h3-9,11-12,15,20,25H,2,10,13-14H2,1H3,(H,24,26)(H,27,28,29)/t20-/m0/s1 |
| InChIKey | UIAZWGVZVAATRB-FQEVSTJZSA-N |
| XLogP | 3.95 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|