About 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole
2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole (PubChem CID 24857852) has the molecular formula C10H13N5O2S3
and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole |
| PubChem CID | 24857852 |
| Molecular Formula | C10H13N5O2S3 |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole |
| SMILES | CCSCCSc1nnc(-c2ncc([N+](=O)[O-])n2C)s1 |
| InChI | InChI=1S/C10H13N5O2S3/c1-3-18-4-5-19-10-13-12-9(20-10)8-11-6-7(14(8)2)15(16)17/h6H,3-5H2,1-2H3 |
| InChIKey | FHKXDNAUJGGFJW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole?
The IUPAC name of 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole (CID 24857852) is 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole is CCSCCSc1nnc(-c2ncc([N+](=O)[O-])n2C)s1.
What is the InChIKey of 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole?
The InChIKey is FHKXDNAUJGGFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O2S3/c1-3-18-4-5-19-10-13-12-9(20-10)8-11-6-7(14(8)2)15(16)17/h6H,3-5H2,1-2H3.
What are the key properties of 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole?
2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole has a molecular weight of 331.45 g/mol, XLogP of 2.69, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylsulfanylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole is sourced from PubChem (CID 24857852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).