C14H20O4 — CID 24858136
(4'aR,8'S)-8'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 24858136) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (4'aR,8'S)-8'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | (4'aR,8'S)-8'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 24858136 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (4'aR,8'S)-8'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | CC1=C2[C@@H](O)CCC3(OCCO3)[C@]2(C)CCC1=O |
| InChI | InChI=1S/C14H20O4/c1-9-10(15)3-5-13(2)12(9)11(16)4-6-14(13)17-7-8-18-14/h11,16H,3-8H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | FUWHULFCKLGXQJ-WCQYABFASA-N |
| XLogP | 1.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |