C24H22O4 — CID 24858298
(2S,4R,5S)-7'-methoxy-2,5-diphenylspiro[1,3-dioxolane-4,2'-3,4-dihydrochromene] (PubChem CID 24858298) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2S,4R,5S)-7'-methoxy-2,5-diphenylspiro[1,3-dioxolane-4,2'-3,4-dihydrochromene].
| Compound Name | (2S,4R,5S)-7'-methoxy-2,5-diphenylspiro[1,3-dioxolane-4,2'-3,4-dihydrochromene] |
|---|---|
| PubChem CID | 24858298 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2S,4R,5S)-7'-methoxy-2,5-diphenylspiro[1,3-dioxolane-4,2'-3,4-dihydrochromene] |
| SMILES | COc1ccc2c(c1)O[C@]1(CC2)O[C@@H](c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22O4/c1-25-20-13-12-17-14-15-24(27-21(17)16-20)22(18-8-4-2-5-9-18)26-23(28-24)19-10-6-3-7-11-19/h2-13,16,22-23H,14-15H2,1H3/t22-,23-,24+/m0/s1 |
| InChIKey | KZIXTVCCPIJBKJ-KMDXXIMOSA-N |
| XLogP | 5.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |