About 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde
6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24858817) has the molecular formula C19H19NOS
and a molecular weight of 309.43 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 24858817 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CN(C)c1ccc(C2CC(c3cccs3)=CC=C2C=O)cc1 |
| InChI | InChI=1S/C19H19NOS/c1-20(2)17-9-7-14(8-10-17)18-12-15(5-6-16(18)13-21)19-4-3-11-22-19/h3-11,13,18H,12H2,1-2H3 |
| InChIKey | SMIOMZLPHMXYMR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde (CID 24858817) is 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde is CN(C)c1ccc(C2CC(c3cccs3)=CC=C2C=O)cc1.
What is the InChIKey of 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is SMIOMZLPHMXYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NOS/c1-20(2)17-9-7-14(8-10-17)18-12-15(5-6-16(18)13-21)19-4-3-11-22-19/h3-11,13,18H,12H2,1-2H3.
What are the key properties of 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde?
6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 309.43 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(dimethylamino)phenyl]-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 24858817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).