C15H10F3N5O — CID 24858859
1-pyrazin-2-yl-3-[6-(trifluoromethyl)quinolin-4-yl]urea (PubChem CID 24858859) has the molecular formula C15H10F3N5O and a molecular weight of 333.27 g/mol. Its IUPAC name is 1-pyrazin-2-yl-3-[6-(trifluoromethyl)quinolin-4-yl]urea.
| Compound Name | 1-pyrazin-2-yl-3-[6-(trifluoromethyl)quinolin-4-yl]urea |
|---|---|
| PubChem CID | 24858859 |
| Molecular Formula | C15H10F3N5O |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-pyrazin-2-yl-3-[6-(trifluoromethyl)quinolin-4-yl]urea |
| SMILES | O=C(Nc1cnccn1)Nc1ccnc2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C15H10F3N5O/c16-15(17,18)9-1-2-11-10(7-9)12(3-4-20-11)22-14(24)23-13-8-19-5-6-21-13/h1-8H,(H2,20,21,22,23,24) |
| InChIKey | GHAZVJQMLWOQLP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |