About 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde
4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24859121) has the molecular formula C19H16O
and a molecular weight of 260.34 g/mol. Its IUPAC name is 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 24859121 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | O=CC1=CC=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C19H16O/c20-14-18-12-11-17(15-7-3-1-4-8-15)13-19(18)16-9-5-2-6-10-16/h1-12,14,19H,13H2 |
| InChIKey | VDWGQJBPYJTETH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde (CID 24859121) is 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde is O=CC1=CC=C(c2ccccc2)CC1c1ccccc1.
What is the InChIKey of 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is VDWGQJBPYJTETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O/c20-14-18-12-11-17(15-7-3-1-4-8-15)13-19(18)16-9-5-2-6-10-16/h1-12,14,19H,13H2.
What are the key properties of 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde?
4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 260.34 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diphenylcyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 24859121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).