C20H14N6O12 — CID 24859325
methyl 3-[[4-(3-methoxycarbonylphenoxy)-6-(trinitromethyl)-1,3,5-triazin-2-yl]oxy]benzoate (PubChem CID 24859325) has the molecular formula C20H14N6O12 and a molecular weight of 530.36 g/mol. Its IUPAC name is methyl 3-[[4-(3-methoxycarbonylphenoxy)-6-(trinitromethyl)-1,3,5-triazin-2-yl]oxy]benzoate.
| Compound Name | methyl 3-[[4-(3-methoxycarbonylphenoxy)-6-(trinitromethyl)-1,3,5-triazin-2-yl]oxy]benzoate |
|---|---|
| PubChem CID | 24859325 |
| Molecular Formula | C20H14N6O12 |
| Molecular Weight | 530.36 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | methyl 3-[[4-(3-methoxycarbonylphenoxy)-6-(trinitromethyl)-1,3,5-triazin-2-yl]oxy]benzoate |
| SMILES | COC(=O)c1cccc(Oc2nc(Oc3cccc(C(=O)OC)c3)nc(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C20H14N6O12/c1-35-15(27)11-5-3-7-13(9-11)37-18-21-17(20(24(29)30,25(31)32)26(33)34)22-19(23-18)38-14-8-4-6-12(10-14)16(28)36-2/h3-10H,1-2H3 |
| InChIKey | NMSHBNQRSZPIRC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 239.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|