C18H18FNO6 — CID 24859344
5-[(E)-1-fluoro-2-(4-methoxy-3-nitrophenyl)ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 24859344) has the molecular formula C18H18FNO6 and a molecular weight of 363.34 g/mol. Its IUPAC name is 5-[(E)-1-fluoro-2-(4-methoxy-3-nitrophenyl)ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(E)-1-fluoro-2-(4-methoxy-3-nitrophenyl)ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 24859344 |
| Molecular Formula | C18H18FNO6 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 5-[(E)-1-fluoro-2-(4-methoxy-3-nitrophenyl)ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1ccc(/C=C(/F)c2cc(OC)c(OC)c(OC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18FNO6/c1-23-15-6-5-11(8-14(15)20(21)22)7-13(19)12-9-16(24-2)18(26-4)17(10-12)25-3/h5-10H,1-4H3/b13-7+ |
| InChIKey | KIXSZXOSDLWBNF-NTUHNPAUSA-N |
| XLogP | 4.10 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|