C15H26O2 — CID 24859456
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-1,3-dioxolane (PubChem CID 24859456) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 24859456 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-1,3-dioxolane |
| SMILES | CC(C)=CCC/C(C)=C/CCC1(C)OCCO1 |
| InChI | InChI=1S/C15H26O2/c1-13(2)7-5-8-14(3)9-6-10-15(4)16-11-12-17-15/h7,9H,5-6,8,10-12H2,1-4H3/b14-9+ |
| InChIKey | SMCMMJBLYPTGIT-NTEUORMPSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|