About 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde
6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24859827) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 24859827 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | Cc1ccc(C2=CC=C(C=O)C(C)(C)C2)o1 |
| InChI | InChI=1S/C14H16O2/c1-10-4-7-13(16-10)11-5-6-12(9-15)14(2,3)8-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | HKBJWEWXJRDDNS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde (CID 24859827) is 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde is Cc1ccc(C2=CC=C(C=O)C(C)(C)C2)o1.
What is the InChIKey of 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is HKBJWEWXJRDDNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-10-4-7-13(16-10)11-5-6-12(9-15)14(2,3)8-11/h4-7,9H,8H2,1-3H3.
What are the key properties of 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde?
6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 216.28 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-4-(5-methylfuran-2-yl)cyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 24859827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).