C14H16OS — CID 24859966
5,6,6-trimethyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24859966) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is 5,6,6-trimethyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 5,6,6-trimethyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 24859966 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 5,6,6-trimethyl-4-thiophen-2-ylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1C(c2cccs2)=CC=C(C=O)C1(C)C |
| InChI | InChI=1S/C14H16OS/c1-10-12(13-5-4-8-16-13)7-6-11(9-15)14(10,2)3/h4-10H,1-3H3 |
| InChIKey | VHUIQLYCEORYRB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|