C23H44O2Si — CID 24860032
(4S,5S,6R,7S,8E)-6-[tert-butyl(dimethyl)silyl]oxy-9-cyclohexyl-5,7-dimethylnona-1,8-dien-4-ol (PubChem CID 24860032) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (4S,5S,6R,7S,8E)-6-[tert-butyl(dimethyl)silyl]oxy-9-cyclohexyl-5,7-dimethylnona-1,8-dien-4-ol.
| Compound Name | (4S,5S,6R,7S,8E)-6-[tert-butyl(dimethyl)silyl]oxy-9-cyclohexyl-5,7-dimethylnona-1,8-dien-4-ol |
|---|---|
| PubChem CID | 24860032 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (4S,5S,6R,7S,8E)-6-[tert-butyl(dimethyl)silyl]oxy-9-cyclohexyl-5,7-dimethylnona-1,8-dien-4-ol |
| SMILES | C=CC[C@H](O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C23H44O2Si/c1-9-13-21(24)19(3)22(25-26(7,8)23(4,5)6)18(2)16-17-20-14-11-10-12-15-20/h9,16-22,24H,1,10-15H2,2-8H3/b17-16+/t18-,19-,21-,22+/m0/s1 |
| InChIKey | QEZLWVNQYNCXNF-NSNGWNOYSA-N |
| XLogP | 6.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|