C21H44O4Si2 — CID 24860034
2-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]acetaldehyde (PubChem CID 24860034) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 24860034 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 2-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]acetaldehyde |
| SMILES | C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)O[C@H]1CC=O |
| InChI | InChI=1S/C21H44O4Si2/c1-15-17(13-14-22)23-19(25-27(11,12)21(6,7)8)16(2)18(15)24-26(9,10)20(3,4)5/h14-19H,13H2,1-12H3/t15-,16+,17-,18-,19-/m0/s1 |
| InChIKey | JUMJPAZPTWWJDY-PJVZLEMVSA-N |
| XLogP | 5.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|