About 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile
4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile (PubChem CID 24860132) has the molecular formula C20H16ClN3O2
and a molecular weight of 365.82 g/mol. Its IUPAC name is 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile |
| PubChem CID | 24860132 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cncc(C#N)c2Nc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C20H16ClN3O2/c1-25-18-8-3-13(9-19(18)26-2)17-12-23-11-14(10-22)20(17)24-16-6-4-15(21)5-7-16/h3-9,11-12H,1-2H3,(H,23,24) |
| InChIKey | XBRSPOIYHCTXLY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile?
The IUPAC name of 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile (CID 24860132) is 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile.
What is the SMILES notation for 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile?
The canonical SMILES for 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile is COc1ccc(-c2cncc(C#N)c2Nc2ccc(Cl)cc2)cc1OC.
What is the InChIKey of 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile?
The InChIKey is XBRSPOIYHCTXLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O2/c1-25-18-8-3-13(9-19(18)26-2)17-12-23-11-14(10-22)20(17)24-16-6-4-15(21)5-7-16/h3-9,11-12H,1-2H3,(H,23,24).
What are the key properties of 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile?
4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile has a molecular weight of 365.82 g/mol, XLogP of 5.03, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chloroanilino)-5-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile is sourced from PubChem (CID 24860132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).