C29H40ClFO6S — CID 24860137
2,2-bis(hydroxymethyl)butyl (E)-7-[(1R,2R,3S,5S)-2-[3-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate (PubChem CID 24860137) has the molecular formula C29H40ClFO6S and a molecular weight of 571.15 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)butyl (E)-7-[(1R,2R,3S,5S)-2-[3-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | 2,2-bis(hydroxymethyl)butyl (E)-7-[(1R,2R,3S,5S)-2-[3-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 24860137 |
| Molecular Formula | C29H40ClFO6S |
| Molecular Weight | 571.15 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 2,2-bis(hydroxymethyl)butyl (E)-7-[(1R,2R,3S,5S)-2-[3-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCC(CO)(CO)COC(=O)CCC/C=C/C[C@@H]1[C@@H](CCC(O)c2sc3ccccc3c2Cl)[C@@H](F)C[C@@H]1O |
| InChI | InChI=1S/C29H40ClFO6S/c1-2-29(16-32,17-33)18-37-26(36)12-6-4-3-5-9-20-19(22(31)15-24(20)35)13-14-23(34)28-27(30)21-10-7-8-11-25(21)38-28/h3,5,7-8,10-11,19-20,22-24,32-35H,2,4,6,9,12-18H2,1H3/b5-3+/t19-,20-,22+,23?,24+/m1/s1 |
| InChIKey | NVHPYLYXENAHTO-UITSDMIGSA-N |
| XLogP | 5.74 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.15 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|