C33H66O8Si2 — CID 24860181
(Z,2R,3S,4S,7S)-8-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-3,7-bis(methoxymethoxy)-2,4-dimethyloct-5-enal (PubChem CID 24860181) has the molecular formula C33H66O8Si2 and a molecular weight of 647.06 g/mol. Its IUPAC name is (Z,2R,3S,4S,7S)-8-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-3,7-bis(methoxymethoxy)-2,4-dimethyloct-5-enal.
| Compound Name | (Z,2R,3S,4S,7S)-8-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-3,7-bis(methoxymethoxy)-2,4-dimethyloct-5-enal |
|---|---|
| PubChem CID | 24860181 |
| Molecular Formula | C33H66O8Si2 |
| Molecular Weight | 647.06 g/mol |
| Exact Mass | 646.43 |
| IUPAC Name | (Z,2R,3S,4S,7S)-8-[(2S,3S,4S,5R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloxan-2-yl]-3,7-bis(methoxymethoxy)-2,4-dimethyloct-5-enal |
| SMILES | COCO[C@H]([C@@H](C)C=O)[C@@H](C)/C=C\[C@H](C[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C)OCOC |
| InChI | InChI=1S/C33H66O8Si2/c1-23(29(24(2)20-34)38-22-36-12)17-18-27(37-21-35-11)19-28-25(3)30(40-42(13,14)32(5,6)7)26(4)31(39-28)41-43(15,16)33(8,9)10/h17-18,20,23-31H,19,21-22H2,1-16H3/b18-17-/t23-,24-,25-,26+,27+,28-,29-,30-,31-/m0/s1 |
| InChIKey | AKXQAELMMDZHCZ-OUOWRQQWSA-N |
| XLogP | 7.79 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.06 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|