C27H43FO6S — CID 24860277
[(2S,4S)-4-hydroxypentan-2-yl] 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 24860277) has the molecular formula C27H43FO6S and a molecular weight of 514.70 g/mol. Its IUPAC name is [(2S,4S)-4-hydroxypentan-2-yl] 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | [(2S,4S)-4-hydroxypentan-2-yl] 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 24860277 |
| Molecular Formula | C27H43FO6S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [(2S,4S)-4-hydroxypentan-2-yl] 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | C[C@H](O)C[C@H](C)OC(=O)CCCCCC[C@@H]1[C@@H](CC[C@@H](O)CSc2ccccc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H43FO6S/c1-18(29)15-19(2)34-27(33)12-6-4-3-5-9-21-22(25(32)16-24(21)31)14-13-20(30)17-35-26-11-8-7-10-23(26)28/h7-8,10-11,18-22,24-25,29-32H,3-6,9,12-17H2,1-2H3/t18-,19-,20+,21+,22+,24-,25+/m0/s1 |
| InChIKey | KAQCLVTYMWZGGO-LSHGYBQWSA-N |
| XLogP | 4.46 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|