About trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate
trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate (PubChem CID 24860311) has the molecular formula C6H5Na3O7S
and a molecular weight of 290.14 g/mol. Its IUPAC name is trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate.
Molecular Properties
| Compound Name | trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate |
| PubChem CID | 24860311 |
| Molecular Formula | C6H5Na3O7S |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate |
| SMILES | O=C([O-])CS[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H8O7S.3Na/c7-2(8)1-14-4(6(12)13)3(9)5(10)11;;;/h3-4,9H,1H2,(H,7,8)(H,10,11)(H,12,13);;;/q;3*+1/p-3/t3-,4+;;;/m1.../s1 |
| InChIKey | LIASRQURHQNPID-MGFVMINGSA-K |
| XLogP | -14.29 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | -14.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate?
The IUPAC name of trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate (CID 24860311) is trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate.
What is the SMILES notation for trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate?
The canonical SMILES for trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate is O=C([O-])CS[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate?
The InChIKey is LIASRQURHQNPID-MGFVMINGSA-K. The full InChI is InChI=1S/C6H8O7S.3Na/c7-2(8)1-14-4(6(12)13)3(9)5(10)11;;;/h3-4,9H,1H2,(H,7,8)(H,10,11)(H,12,13);;;/q;3*+1/p-3/t3-,4+;;;/m1.../s1.
What are the key properties of trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate?
trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate has a molecular weight of 290.14 g/mol, XLogP of -14.29, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;(2S,3S)-2-(carboxylatomethylsulfanyl)-3-hydroxybutanedioate is sourced from PubChem (CID 24860311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).