About 3-heptoxybenzoate
3-heptoxybenzoate (PubChem CID 24860417) has the molecular formula C14H19O3-
and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-heptoxybenzoate.
Molecular Properties
| Compound Name | 3-heptoxybenzoate |
| PubChem CID | 24860417 |
| Molecular Formula | C14H19O3- |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-heptoxybenzoate |
| SMILES | CCCCCCCOc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C14H20O3/c1-2-3-4-5-6-10-17-13-9-7-8-12(11-13)14(15)16/h7-9,11H,2-6,10H2,1H3,(H,15,16)/p-1 |
| InChIKey | FOFZVIUYGPBWLV-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-heptoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptoxybenzoate?
The IUPAC name of 3-heptoxybenzoate (CID 24860417) is 3-heptoxybenzoate.
What is the SMILES notation for 3-heptoxybenzoate?
The canonical SMILES for 3-heptoxybenzoate is CCCCCCCOc1cccc(C(=O)[O-])c1.
What is the InChIKey of 3-heptoxybenzoate?
The InChIKey is FOFZVIUYGPBWLV-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H20O3/c1-2-3-4-5-6-10-17-13-9-7-8-12(11-13)14(15)16/h7-9,11H,2-6,10H2,1H3,(H,15,16)/p-1.
What are the key properties of 3-heptoxybenzoate?
3-heptoxybenzoate has a molecular weight of 235.30 g/mol, XLogP of 2.40, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptoxybenzoate is sourced from PubChem (CID 24860417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).