C22H32N4O5S — CID 24860425
4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-1-N,1-N-diethyl-4-N-hydroxypiperidine-1,4-dicarboxamide (PubChem CID 24860425) has the molecular formula C22H32N4O5S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-1-N,1-N-diethyl-4-N-hydroxypiperidine-1,4-dicarboxamide.
| Compound Name | 4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-1-N,1-N-diethyl-4-N-hydroxypiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 24860425 |
| Molecular Formula | C22H32N4O5S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[[4-(but-2-ynylamino)phenyl]sulfonylmethyl]-1-N,1-N-diethyl-4-N-hydroxypiperidine-1,4-dicarboxamide |
| SMILES | CC#CCNc1ccc(S(=O)(=O)CC2(C(=O)NO)CCN(C(=O)N(CC)CC)CC2)cc1 |
| InChI | InChI=1S/C22H32N4O5S/c1-4-7-14-23-18-8-10-19(11-9-18)32(30,31)17-22(20(27)24-29)12-15-26(16-13-22)21(28)25(5-2)6-3/h8-11,23,29H,5-6,12-17H2,1-3H3,(H,24,27) |
| InChIKey | HGILVKJBXAXGDH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|