C43H48N4O6 — CID 24860464
2-[1-[[2-[5-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]pentoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide (PubChem CID 24860464) has the molecular formula C43H48N4O6 and a molecular weight of 716.88 g/mol. Its IUPAC name is 2-[1-[[2-[5-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]pentoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide.
| Compound Name | 2-[1-[[2-[5-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]pentoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide |
|---|---|
| PubChem CID | 24860464 |
| Molecular Formula | C43H48N4O6 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | 2-[1-[[2-[5-[2-[[3-(2-amino-2-oxoethyl)-5-methoxy-2-methylindol-1-yl]methyl]phenoxy]pentoxy]phenyl]methyl]-5-methoxy-2-methylindol-3-yl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(N)=O)c(C)n2Cc1ccccc1OCCCCCOc1ccccc1Cn1c(C)c(CC(N)=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C43H48N4O6/c1-28-34(24-42(44)48)36-22-32(50-3)16-18-38(36)46(28)26-30-12-6-8-14-40(30)52-20-10-5-11-21-53-41-15-9-7-13-31(41)27-47-29(2)35(25-43(45)49)37-23-33(51-4)17-19-39(37)47/h6-9,12-19,22-23H,5,10-11,20-21,24-27H2,1-4H3,(H2,44,48)(H2,45,49) |
| InChIKey | ICVBCKCDIUJXEI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|