About (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one
(3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one (PubChem CID 2486056) has the molecular formula C17H11F3O3S
and a molecular weight of 352.33 g/mol. Its IUPAC name is (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one.
Molecular Properties
| Compound Name | (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one |
| PubChem CID | 2486056 |
| Molecular Formula | C17H11F3O3S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one |
| SMILES | O=C1/C(=C/c2cccc(C(F)(F)F)c2)CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H11F3O3S/c18-17(19,20)13-5-3-4-11(9-13)8-12-10-24(22,23)15-7-2-1-6-14(15)16(12)21/h1-9H,10H2/b12-8+ |
| InChIKey | USNWKZVXAQTEEJ-XYOKQWHBSA-N |
| XLogP | 3.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one?
The IUPAC name of (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one (CID 2486056) is (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one.
What is the SMILES notation for (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one?
The canonical SMILES for (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one is O=C1/C(=C/c2cccc(C(F)(F)F)c2)CS(=O)(=O)c2ccccc21.
What is the InChIKey of (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one?
The InChIKey is USNWKZVXAQTEEJ-XYOKQWHBSA-N. The full InChI is InChI=1S/C17H11F3O3S/c18-17(19,20)13-5-3-4-11(9-13)8-12-10-24(22,23)15-7-2-1-6-14(15)16(12)21/h1-9H,10H2/b12-8+.
What are the key properties of (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one?
(3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one has a molecular weight of 352.33 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1,1-dioxo-3-[[3-(trifluoromethyl)phenyl]methylidene]thiochromen-4-one is sourced from PubChem (CID 2486056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).