C20H28F3N2O6PS — CID 24860613
[(2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 24860613) has the molecular formula C20H28F3N2O6PS and a molecular weight of 512.49 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 24860613 |
| Molecular Formula | C20H28F3N2O6PS |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [(2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | CCCCCOCCOc1ccc(-c2cnc([C@@](C)(N)COP(=O)(O)O)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H28F3N2O6PS/c1-3-4-5-8-29-9-10-30-16-7-6-14(11-15(16)20(21,22)23)17-12-25-18(33-17)19(2,24)13-31-32(26,27)28/h6-7,11-12H,3-5,8-10,13,24H2,1-2H3,(H2,26,27,28)/t19-/m0/s1 |
| InChIKey | VZMMWAPTAUAHJO-IBGZPJMESA-N |
| XLogP | 4.70 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|