About 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine
9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine (PubChem CID 24860861) has the molecular formula C15H18N6O2
and a molecular weight of 314.35 g/mol. Its IUPAC name is 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine.
Molecular Properties
| Compound Name | 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine |
| PubChem CID | 24860861 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine |
| SMILES | COCCOc1nc(N)c2nc(N)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C15H18N6O2/c1-22-7-8-23-15-19-12(16)11-13(20-15)21(14(17)18-11)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H2,17,18)(H2,16,19,20) |
| InChIKey | LCRBMFXDUAURGO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine?
The IUPAC name of 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine (CID 24860861) is 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine.
What is the SMILES notation for 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine?
The canonical SMILES for 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine is COCCOc1nc(N)c2nc(N)n(Cc3ccccc3)c2n1.
What is the InChIKey of 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine?
The InChIKey is LCRBMFXDUAURGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6O2/c1-22-7-8-23-15-19-12(16)11-13(20-15)21(14(17)18-11)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H2,17,18)(H2,16,19,20).
What are the key properties of 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine?
9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine has a molecular weight of 314.35 g/mol, XLogP of 1.06, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-2-(2-methoxyethoxy)purine-6,8-diamine is sourced from PubChem (CID 24860861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).