About [1-(3,4-dichlorophenyl)cycloheptyl]methanamine
[1-(3,4-dichlorophenyl)cycloheptyl]methanamine (PubChem CID 24860902) has the molecular formula C14H19Cl2N
and a molecular weight of 272.22 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)cycloheptyl]methanamine.
Molecular Properties
| Compound Name | [1-(3,4-dichlorophenyl)cycloheptyl]methanamine |
| PubChem CID | 24860902 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [1-(3,4-dichlorophenyl)cycloheptyl]methanamine |
| SMILES | NCC1(c2ccc(Cl)c(Cl)c2)CCCCCC1 |
| InChI | InChI=1S/C14H19Cl2N/c15-12-6-5-11(9-13(12)16)14(10-17)7-3-1-2-4-8-14/h5-6,9H,1-4,7-8,10,17H2 |
| InChIKey | NMFAKPRDDDKVBP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-(3,4-dichlorophenyl)cycloheptyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dichlorophenyl)cycloheptyl]methanamine?
The IUPAC name of [1-(3,4-dichlorophenyl)cycloheptyl]methanamine (CID 24860902) is [1-(3,4-dichlorophenyl)cycloheptyl]methanamine.
What is the SMILES notation for [1-(3,4-dichlorophenyl)cycloheptyl]methanamine?
The canonical SMILES for [1-(3,4-dichlorophenyl)cycloheptyl]methanamine is NCC1(c2ccc(Cl)c(Cl)c2)CCCCCC1.
What is the InChIKey of [1-(3,4-dichlorophenyl)cycloheptyl]methanamine?
The InChIKey is NMFAKPRDDDKVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2N/c15-12-6-5-11(9-13(12)16)14(10-17)7-3-1-2-4-8-14/h5-6,9H,1-4,7-8,10,17H2.
What are the key properties of [1-(3,4-dichlorophenyl)cycloheptyl]methanamine?
[1-(3,4-dichlorophenyl)cycloheptyl]methanamine has a molecular weight of 272.22 g/mol, XLogP of 4.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dichlorophenyl)cycloheptyl]methanamine is sourced from PubChem (CID 24860902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).