About 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine
1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine (PubChem CID 24860904) has the molecular formula C14H19Cl2N
and a molecular weight of 272.22 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine.
Molecular Properties
| Compound Name | 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine |
| PubChem CID | 24860904 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine |
| SMILES | CC(N)C1(c2ccc(Cl)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C14H19Cl2N/c1-10(17)14(7-3-2-4-8-14)11-5-6-12(15)13(16)9-11/h5-6,9-10H,2-4,7-8,17H2,1H3 |
| InChIKey | XAXLSVQFDZVYNG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine?
The IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine (CID 24860904) is 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine.
What is the SMILES notation for 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine?
The canonical SMILES for 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine is CC(N)C1(c2ccc(Cl)c(Cl)c2)CCCCC1.
What is the InChIKey of 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine?
The InChIKey is XAXLSVQFDZVYNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2N/c1-10(17)14(7-3-2-4-8-14)11-5-6-12(15)13(16)9-11/h5-6,9-10H,2-4,7-8,17H2,1H3.
What are the key properties of 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine?
1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine has a molecular weight of 272.22 g/mol, XLogP of 4.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dichlorophenyl)cyclohexyl]ethanamine is sourced from PubChem (CID 24860904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).