C24H22F2N4O2 — CID 24861010
1-[(3,4-difluorophenyl)methyl]-2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]pyridine-3-carboxamide (PubChem CID 24861010) has the molecular formula C24H22F2N4O2 and a molecular weight of 436.46 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]pyridine-3-carboxamide.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24861010 |
| Molecular Formula | C24H22F2N4O2 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCCc1c[nH]c2ncccc12)c1cccn(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C24H22F2N4O2/c25-20-9-8-16(13-21(20)26)15-30-12-4-7-19(24(30)32)23(31)28-10-2-1-5-17-14-29-22-18(17)6-3-11-27-22/h3-4,6-9,11-14H,1-2,5,10,15H2,(H,27,29)(H,28,31) |
| InChIKey | QBRWFYMTZNXFBJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|