C19H24BFN4O4 — CID 24861289
[(1R)-1-[[(2S)-3-(4-fluorophenyl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 24861289) has the molecular formula C19H24BFN4O4 and a molecular weight of 402.24 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-3-(4-fluorophenyl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-3-(4-fluorophenyl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 24861289 |
| Molecular Formula | C19H24BFN4O4 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [(1R)-1-[[(2S)-3-(4-fluorophenyl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1cnccn1)B(O)O |
| InChI | InChI=1S/C19H24BFN4O4/c1-12(2)9-17(20(28)29)25-18(26)15(10-13-3-5-14(21)6-4-13)24-19(27)16-11-22-7-8-23-16/h3-8,11-12,15,17,28-29H,9-10H2,1-2H3,(H,24,27)(H,25,26)/t15-,17-/m0/s1 |
| InChIKey | AYMHFGFFCJQPHO-RDJZCZTQSA-N |
| XLogP | 0.50 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|