C18H20F3N3S — CID 24861565
(1S,2R,5S)-5-(2-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 24861565) has the molecular formula C18H20F3N3S and a molecular weight of 367.44 g/mol. Its IUPAC name is (1S,2R,5S)-5-(2-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (1S,2R,5S)-5-(2-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 24861565 |
| Molecular Formula | C18H20F3N3S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (1S,2R,5S)-5-(2-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | Cc1nc2c(s1)CN([C@H]1CC[C@H](c3cc(F)c(F)cc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C18H20F3N3S/c1-9-23-17-7-24(8-18(17)25-9)10-2-3-11(16(22)4-10)12-5-14(20)15(21)6-13(12)19/h5-6,10-11,16H,2-4,7-8,22H2,1H3/t10-,11+,16-/m0/s1 |
| InChIKey | YIUHSDAXKVJDPG-USBNGQNGSA-N |
| XLogP | 3.85 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|