C18H15BrCl2F2NO3P — CID 24861653
[[2-bromo-4-[(6,7-dichloro-2,3-dimethylindol-1-yl)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 24861653) has the molecular formula C18H15BrCl2F2NO3P and a molecular weight of 513.10 g/mol. Its IUPAC name is [[2-bromo-4-[(6,7-dichloro-2,3-dimethylindol-1-yl)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(6,7-dichloro-2,3-dimethylindol-1-yl)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 24861653 |
| Molecular Formula | C18H15BrCl2F2NO3P |
| Molecular Weight | 513.10 g/mol |
| Exact Mass | 510.93 |
| IUPAC Name | [[2-bromo-4-[(6,7-dichloro-2,3-dimethylindol-1-yl)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1c(C)n(Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)c2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C18H15BrCl2F2NO3P/c1-9-10(2)24(17-12(9)4-6-15(20)16(17)21)8-11-3-5-13(14(19)7-11)18(22,23)28(25,26)27/h3-7H,8H2,1-2H3,(H2,25,26,27) |
| InChIKey | ANDBSEYFRCLSAB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.10 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|