C20H17N3O3 — CID 24861912
7-hydroxy-19-(1-hydroxyethyl)-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one (PubChem CID 24861912) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 7-hydroxy-19-(1-hydroxyethyl)-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one.
| Compound Name | 7-hydroxy-19-(1-hydroxyethyl)-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one |
|---|---|
| PubChem CID | 24861912 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 7-hydroxy-19-(1-hydroxyethyl)-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one |
| SMILES | CC(O)c1cncc2c(=O)n3c(cc12)-c1[nH]c2ccc(O)cc2c1CC3 |
| InChI | InChI=1S/C20H17N3O3/c1-10(24)15-8-21-9-16-13(15)7-18-19-12(4-5-23(18)20(16)26)14-6-11(25)2-3-17(14)22-19/h2-3,6-10,22,24-25H,4-5H2,1H3 |
| InChIKey | PUVMSXKEPGXEHQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|