About 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione
1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione (PubChem CID 24862007) has the molecular formula C9H10N4O3
and a molecular weight of 222.20 g/mol. Its IUPAC name is 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione.
Molecular Properties
| Compound Name | 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione |
| PubChem CID | 24862007 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione |
| SMILES | CC(=O)CCn1cnc2[nH]c(=O)[nH]c2c1=O |
| InChI | InChI=1S/C9H10N4O3/c1-5(14)2-3-13-4-10-7-6(8(13)15)11-9(16)12-7/h4H,2-3H2,1H3,(H2,11,12,16) |
| InChIKey | PMNDTYDFQFLPGU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione?
The IUPAC name of 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione (CID 24862007) is 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione.
What is the SMILES notation for 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione?
The canonical SMILES for 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione is CC(=O)CCn1cnc2[nH]c(=O)[nH]c2c1=O.
What is the InChIKey of 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione?
The InChIKey is PMNDTYDFQFLPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3/c1-5(14)2-3-13-4-10-7-6(8(13)15)11-9(16)12-7/h4H,2-3H2,1H3,(H2,11,12,16).
What are the key properties of 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione?
1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione has a molecular weight of 222.20 g/mol, XLogP of -0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-oxobutyl)-7,9-dihydropurine-6,8-dione is sourced from PubChem (CID 24862007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).