About tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate
tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate (PubChem CID 24862144) has the molecular formula C10H12Cl2N4O2
and a molecular weight of 291.14 g/mol. Its IUPAC name is tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate |
| PubChem CID | 24862144 |
| Molecular Formula | C10H12Cl2N4O2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C/c1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C10H12Cl2N4O2/c1-10(2,3)18-9(17)16-15-4-6-7(11)13-5-14-8(6)12/h4-5H,1-3H3,(H,16,17)/b15-4+ |
| InChIKey | ATVNNSMWBAQDOK-SYZQJQIISA-N |
| XLogP | 2.64 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate?
The IUPAC name of tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate (CID 24862144) is tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate.
What is the SMILES notation for tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate?
The canonical SMILES for tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate is CC(C)(C)OC(=O)N/N=C/c1c(Cl)ncnc1Cl.
What is the InChIKey of tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate?
The InChIKey is ATVNNSMWBAQDOK-SYZQJQIISA-N. The full InChI is InChI=1S/C10H12Cl2N4O2/c1-10(2,3)18-9(17)16-15-4-6-7(11)13-5-14-8(6)12/h4-5H,1-3H3,(H,16,17)/b15-4+.
What are the key properties of tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate?
tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate has a molecular weight of 291.14 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E)-(4,6-dichloropyrimidin-5-yl)methylideneamino]carbamate is sourced from PubChem (CID 24862144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).