C27H39NO6S — CID 24862174
(1S,5R,7S,9S,13S,16R,20S)-13,20-dihydroxy-14,14-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,10-dioxatricyclo[14.3.1.05,7]icosane-11,15-dione (PubChem CID 24862174) has the molecular formula C27H39NO6S and a molecular weight of 505.68 g/mol. Its IUPAC name is (1S,5R,7S,9S,13S,16R,20S)-13,20-dihydroxy-14,14-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,10-dioxatricyclo[14.3.1.05,7]icosane-11,15-dione.
| Compound Name | (1S,5R,7S,9S,13S,16R,20S)-13,20-dihydroxy-14,14-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,10-dioxatricyclo[14.3.1.05,7]icosane-11,15-dione |
|---|---|
| PubChem CID | 24862174 |
| Molecular Formula | C27H39NO6S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (1S,5R,7S,9S,13S,16R,20S)-13,20-dihydroxy-14,14-dimethyl-9-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6,10-dioxatricyclo[14.3.1.05,7]icosane-11,15-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C[C@@H]2O[C@@H]2CCC[C@@H]2CCC[C@@H](C(=O)C(C)(C)[C@@H](O)CC(=O)O1)[C@H]2O |
| InChI | InChI=1S/C27H39NO6S/c1-15(11-18-14-35-16(2)28-18)21-12-22-20(33-22)10-6-8-17-7-5-9-19(25(17)31)26(32)27(3,4)23(29)13-24(30)34-21/h11,14,17,19-23,25,29,31H,5-10,12-13H2,1-4H3/b15-11+/t17-,19+,20+,21-,22-,23-,25-/m0/s1 |
| InChIKey | RTICJKQHAGGOLJ-ANZJJFPKSA-N |
| XLogP | 4.23 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|